Hello,
I came across this odd piece of code in org.openscience.cdk.smsd.algorithm.vflib.map.VFState
/** {@inheritDoc} */
public boolean isDead() {
return query.countNodes() > target.getAtomCount();
}
Why is this the case? It prevents me from say, performing a SMARTS match where the SMARTS query is larger than the molecule being tested on.
Whilst that seems pointless (i.e there would never be a isomorphic/100% match), I still need to do this to get partial matches for similarity calculations.
I've manually edited this out of the code at my workstation atm and it works fine, so I don't really see the need for this as it simply prevents anyone from matching a larger query. Strange, coz the algorithm itself is super-fast for graph matching otherwise.
Ed.
This' when I use it with the Isomorphism class.
If you're looking at sub-graph isomorphism your query can not be larger than the target. If you want a partial match, maximum common subgraph (MCS) is what you need.
J
Last edit: John May 2013-06-06
Yeah I'm using the MCS - the VFLib MCS algorithm supplied with CDK. That's where the error's occuring.
got the query/target?
It's another of these cases where I'm using IQueryAtomContainers rather than IAtomContainers (for the SMARTS-matching subgraph isomorphism aspect of my work). Here's an example:
target SMILES: O=C(OCC)CN2C5=CC=C(C=C5(C1=NC=NC(=C12)N4CCN(CCC=3C=CC(F)=C(F)C=3)CC4))N+[O-]
query SMARTS: CCOC(=O)CN8C~2C(~NC(CN1CCOCC1)~NC~2N4CCN(CCC~3C~CC(F)~C(F)C~3)CC4)C~5C8(~C(N(=O)O)C=6=7(NC~5(NC)(C=6(N(=O)O))C=7(N(O)=O)))
So the idea is that I get the maximum common substructure between these & use it to calculate Tanimoto Bond similarity.
Last edit: Duece99 2013-06-06
This will only be fixed in master.
I don't think anymore that this SMSD stack will be fixed at all. Please use the latest SMSD code from the Asad.