Problem 1: Organophosphates are not recognised. For parathion and diazinon we do not get the expected TTC value for
organophosphates but the message, that
QQ1.Is the substance a non-essential metal or metal containing compound,
or is it a polyhalogenated dibenzodioxin, -dibenzofuran, or -biphenyl? Yes
- what is not true.
parathion S=P(Oc1ccc(cc1)N+=O)(OCC)OCC
diazinon S=P(OCC)(OCC)Oc1nc(nc(c1)C)C(C)C
Diff: