From: richard a. <ric...@ya...> - 2006-09-16 21:34:30
|
I've been playing around with generating AuxInfo for chiral InChIs with the -InChI2Struct option: http://sourceforge.net/mailarchive/forum.php?thread_id=30378782&forum_id=45166 It works great, except when I run it on a chiral InChI: InChI=1/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-/m0/s1 (S)-1-phenylethanol I get my AuxInfo: InChI=1/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/t7-/m0/s1 AuxInfo=1/0/N:1,2,3,4,5,6,7,8,9/E:(3,4)(5,6)/it:im/rA:10CCCCCCC.eCOH/rB:;d2;s2;s3;d4;s1;d5s6s7;s7;s7;/rC:;;;;;;;;;; But when I use "cInChI -OutputSDF" on this full InChI, I get only a stereo-free molfile (with an H-atom added to the carbinol carbon: Structure #1 InChI v1 SDfile Output 10 10 0 0 0 0 0 0 0 0 1 V2000 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 H 0 0 0 0 0 0 0 0 0 1 7 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 6 2 0 0 0 0 5 8 2 0 0 0 0 6 8 1 0 0 0 0 7 8 1 0 0 0 0 7 9 1 0 0 0 0 7 10 1 0 0 0 0 M END $$$$ Has the stereo layer been implemented for the InChI->SDF conversion? Is there something else I need to be doing? many thanks, Rich __________________________________________________ Do You Yahoo!? Tired of spam? Yahoo! Mail has the best spam protection around http://mail.yahoo.com |